C20H17Cl2F3N4O2 — CID 56969601
2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,2-trifluoroethyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 56969601) has the molecular formula C20H17Cl2F3N4O2 and a molecular weight of 473.28 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,2-trifluoroethyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,2-trifluoroethyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56969601 |
| Molecular Formula | C20H17Cl2F3N4O2 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,2-trifluoroethyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c(c(C(=O)NCC(F)(F)F)cc3[nH]c(Nc4c(Cl)cccc4Cl)nc23)O1 |
| InChI | InChI=1S/C20H17Cl2F3N4O2/c1-19(2)7-10-14-13(6-9(16(10)31-19)17(30)26-8-20(23,24)25)27-18(28-14)29-15-11(21)4-3-5-12(15)22/h3-6H,7-8H2,1-2H3,(H,26,30)(H2,27,28,29) |
| InChIKey | YRHPYZLJFJBTGA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |