C23H18F3N5 — CID 56969815
2-(5-pyridin-4-yl-2-pyridinyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 56969815) has the molecular formula C23H18F3N5 and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-(5-pyridin-4-yl-2-pyridinyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(5-pyridin-4-yl-2-pyridinyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 56969815 |
| Molecular Formula | C23H18F3N5 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(5-pyridin-4-yl-2-pyridinyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1ccccc1C1CCCn2nc(-c3ccc(-c4ccncc4)cn3)nc21 |
| InChI | InChI=1S/C23H18F3N5/c24-23(25,26)19-6-2-1-4-17(19)18-5-3-13-31-22(18)29-21(30-31)20-8-7-16(14-28-20)15-9-11-27-12-10-15/h1-2,4,6-12,14,18H,3,5,13H2 |
| InChIKey | OCWCTWZRCRRJNQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |