C24H18Cl2F2N4O2 — CID 56970017
2-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 56970017) has the molecular formula C24H18Cl2F2N4O2 and a molecular weight of 503.34 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56970017 |
| Molecular Formula | C24H18Cl2F2N4O2 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c(c(C(=O)Nc3c(F)cccc3F)cc3[nH]c(Nc4c(Cl)cccc4Cl)nc23)O1 |
| InChI | InChI=1S/C24H18Cl2F2N4O2/c1-24(2)10-12-18-17(29-23(31-18)32-19-13(25)5-3-6-14(19)26)9-11(21(12)34-24)22(33)30-20-15(27)7-4-8-16(20)28/h3-9H,10H2,1-2H3,(H,30,33)(H2,29,31,32) |
| InChIKey | OWWGNLVYRPJIMB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |