C24H24Cl2F2N4O2 — CID 56970021
2-(2,6-dichloroanilino)-N-(4,4-difluorocyclohexyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 56970021) has the molecular formula C24H24Cl2F2N4O2 and a molecular weight of 509.38 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-N-(4,4-difluorocyclohexyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-N-(4,4-difluorocyclohexyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56970021 |
| Molecular Formula | C24H24Cl2F2N4O2 |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-(2,6-dichloroanilino)-N-(4,4-difluorocyclohexyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c(c(C(=O)NC3CCC(F)(F)CC3)cc3[nH]c(Nc4c(Cl)cccc4Cl)nc23)O1 |
| InChI | InChI=1S/C24H24Cl2F2N4O2/c1-23(2)11-14-18-17(30-22(31-18)32-19-15(25)4-3-5-16(19)26)10-13(20(14)34-23)21(33)29-12-6-8-24(27,28)9-7-12/h3-5,10,12H,6-9,11H2,1-2H3,(H,29,33)(H2,30,31,32) |
| InChIKey | DDYROGTZYDTUKM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |