C24H37NO4 — CID 56970029
2-[(4-decoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 56970029) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is 2-[(4-decoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(4-decoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 56970029 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 2-[(4-decoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)C2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C24H37NO4/c1-2-3-4-5-6-7-8-11-18-29-20-16-14-19(15-17-20)25-23(26)21-12-9-10-13-22(21)24(27)28/h14-17,21-22H,2-13,18H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | GBSBHHWBORKGSB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|