About 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide
2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide (PubChem CID 56970076) has the molecular formula C9H15ClN4O2
and a molecular weight of 246.70 g/mol. Its IUPAC name is 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide |
| PubChem CID | 56970076 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide |
| SMILES | N/C(CCl)=N/CCC[C@@H]1NC(=O)CNC1=O |
| InChI | InChI=1S/C9H15ClN4O2/c10-4-7(11)12-3-1-2-6-9(16)13-5-8(15)14-6/h6H,1-5H2,(H2,11,12)(H,13,16)(H,14,15)/t6-/m0/s1 |
| InChIKey | FFYQNLLFCMUHBY-LURJTMIESA-N |
| XLogP | -1.02 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide?
The IUPAC name of 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide (CID 56970076) is 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide.
What is the SMILES notation for 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide?
The canonical SMILES for 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide is N/C(CCl)=N/CCC[C@@H]1NC(=O)CNC1=O.
What is the InChIKey of 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide?
The InChIKey is FFYQNLLFCMUHBY-LURJTMIESA-N. The full InChI is InChI=1S/C9H15ClN4O2/c10-4-7(11)12-3-1-2-6-9(16)13-5-8(15)14-6/h6H,1-5H2,(H2,11,12)(H,13,16)(H,14,15)/t6-/m0/s1.
What are the key properties of 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide?
2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide has a molecular weight of 246.70 g/mol, XLogP of -1.02, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]ethanimidamide is sourced from PubChem (CID 56970076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).