C12H17NO4S2 — CID 569704
[2-methyl-3-(2-sulfosulfanylethylamino)propanoyl]benzene (PubChem CID 569704) has the molecular formula C12H17NO4S2 and a molecular weight of 303.40 g/mol. Its IUPAC name is [2-methyl-3-(2-sulfosulfanylethylamino)propanoyl]benzene.
| Compound Name | [2-methyl-3-(2-sulfosulfanylethylamino)propanoyl]benzene |
|---|---|
| PubChem CID | 569704 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [2-methyl-3-(2-sulfosulfanylethylamino)propanoyl]benzene |
| SMILES | CC(CNCCSS(=O)(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO4S2/c1-10(9-13-7-8-18-19(15,16)17)12(14)11-5-3-2-4-6-11/h2-6,10,13H,7-9H2,1H3,(H,15,16,17) |
| InChIKey | HGWYYFUSEIBJRS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|