C23H35NO2 — CID 56970433
3-[(E)-[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylideneamino]oxypropan-1-ol (PubChem CID 56970433) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 3-[(E)-[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylideneamino]oxypropan-1-ol.
| Compound Name | 3-[(E)-[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylideneamino]oxypropan-1-ol |
|---|---|
| PubChem CID | 56970433 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 3-[(E)-[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylideneamino]oxypropan-1-ol |
| SMILES | CC(C)c1ccc2c(c1)CCC1[C@@](C)(/C=N/OCCCO)CCC[C@]21C |
| InChI | InChI=1S/C23H35NO2/c1-17(2)18-7-9-20-19(15-18)8-10-21-22(3,11-5-12-23(20,21)4)16-24-26-14-6-13-25/h7,9,15-17,21,25H,5-6,8,10-14H2,1-4H3/b24-16+/t21?,22-,23-/m1/s1 |
| InChIKey | KJCMKLHAXLZPPA-SVKDSYGISA-N |
| XLogP | 5.21 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|