C15H12ClN3S — CID 56970559
14-chloro-3,5,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),5,12(17),13,15-hexaene-4-thione (PubChem CID 56970559) has the molecular formula C15H12ClN3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 14-chloro-3,5,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),5,12(17),13,15-hexaene-4-thione.
| Compound Name | 14-chloro-3,5,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),5,12(17),13,15-hexaene-4-thione |
|---|---|
| PubChem CID | 56970559 |
| Molecular Formula | C15H12ClN3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 14-chloro-3,5,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),5,12(17),13,15-hexaene-4-thione |
| SMILES | S=c1ncc2c([nH]1)-c1[nH]c3ccc(Cl)cc3c1CCC2 |
| InChI | InChI=1S/C15H12ClN3S/c16-9-4-5-12-11(6-9)10-3-1-2-8-7-17-15(20)19-13(8)14(10)18-12/h4-7,18H,1-3H2,(H,17,19,20) |
| InChIKey | ZWVOZQXTLIOOKE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|