C20H16ClN3O3 — CID 56970564
5-chloro-2'-methyl-5'-phenylspiro[1H-indole-3,3'-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole]-2,4',6'-trione (PubChem CID 56970564) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 5-chloro-2'-methyl-5'-phenylspiro[1H-indole-3,3'-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole]-2,4',6'-trione.
| Compound Name | 5-chloro-2'-methyl-5'-phenylspiro[1H-indole-3,3'-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole]-2,4',6'-trione |
|---|---|
| PubChem CID | 56970564 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-chloro-2'-methyl-5'-phenylspiro[1H-indole-3,3'-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole]-2,4',6'-trione |
| SMILES | CN1CC2C(=O)N(c3ccccc3)C(=O)C2C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C20H16ClN3O3/c1-23-10-13-16(18(26)24(17(13)25)12-5-3-2-4-6-12)20(23)14-9-11(21)7-8-15(14)22-19(20)27/h2-9,13,16H,10H2,1H3,(H,22,27) |
| InChIKey | DILGOMWLIDDFQA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|