C27H38N2O6 — CID 56970646
(1S,4aS)-1-[(E)-3-aminopropoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one;(E)-but-2-enedioic acid (PubChem CID 56970646) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is (1S,4aS)-1-[(E)-3-aminopropoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one;(E)-but-2-enedioic acid.
| Compound Name | (1S,4aS)-1-[(E)-3-aminopropoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 56970646 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (1S,4aS)-1-[(E)-3-aminopropoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one;(E)-but-2-enedioic acid |
| SMILES | CC(C)c1ccc2c(c1)C(=O)CC1[C@@](C)(/C=N/OCCCN)CCC[C@]21C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H34N2O2.C4H4O4/c1-16(2)17-7-8-19-18(13-17)20(26)14-21-22(3,9-5-10-23(19,21)4)15-25-27-12-6-11-24;5-3(6)1-2-4(7)8/h7-8,13,15-16,21H,5-6,9-12,14,24H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b25-15+;2-1+/t21?,22-,23-;/m1./s1 |
| InChIKey | RUGWQFUZRMZBJW-FGQRSMRGSA-N |
| XLogP | 4.52 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|