About N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide
N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide (PubChem CID 56971027) has the molecular formula C21H26N6O
and a molecular weight of 378.48 g/mol. Its IUPAC name is N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide |
| PubChem CID | 56971027 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide |
| SMILES | COc1ccc(N2CCN(CCC/N=C(\NC#N)c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C21H26N6O/c1-28-19-8-6-18(7-9-19)27-15-13-26(14-16-27)12-4-11-24-21(25-17-22)20-5-2-3-10-23-20/h2-3,5-10H,4,11-16H2,1H3,(H,24,25) |
| InChIKey | CVZMDIHZFOVDBI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide?
The IUPAC name of N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide (CID 56971027) is N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide.
What is the SMILES notation for N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide?
The canonical SMILES for N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide is COc1ccc(N2CCN(CCC/N=C(\NC#N)c3ccccn3)CC2)cc1.
What is the InChIKey of N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide?
The InChIKey is CVZMDIHZFOVDBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N6O/c1-28-19-8-6-18(7-9-19)27-15-13-26(14-16-27)12-4-11-24-21(25-17-22)20-5-2-3-10-23-20/h2-3,5-10H,4,11-16H2,1H3,(H,24,25).
What are the key properties of N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide?
N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide has a molecular weight of 378.48 g/mol, XLogP of 2.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyridine-2-carboximidamide is sourced from PubChem (CID 56971027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).