About (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride
(3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 56972027) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 56972027 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cc1ccccc1[C@H]1CNC[C@@H]1C(=O)O.Cl |
| InChI | InChI=1S/C12H15NO2.ClH/c1-8-4-2-3-5-9(8)10-6-13-7-11(10)12(14)15;/h2-5,10-11,13H,6-7H2,1H3,(H,14,15);1H/t10-,11+;/m1./s1 |
| InChIKey | SZHUXHHHBXYABK-DHXVBOOMSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CID 56972027) is (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride is Cc1ccccc1[C@H]1CNC[C@@H]1C(=O)O.Cl.
What is the InChIKey of (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is SZHUXHHHBXYABK-DHXVBOOMSA-N. The full InChI is InChI=1S/C12H15NO2.ClH/c1-8-4-2-3-5-9(8)10-6-13-7-11(10)12(14)15;/h2-5,10-11,13H,6-7H2,1H3,(H,14,15);1H/t10-,11+;/m1./s1.
What are the key properties of (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride?
(3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 241.72 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 56972027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).