About ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate
ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate (PubChem CID 569723) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate |
| PubChem CID | 569723 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(O)(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C21H22O4/c1-2-25-20(23)19-17(15-9-5-3-6-10-15)13-21(24,14-18(19)22)16-11-7-4-8-12-16/h3-12,17,19,24H,2,13-14H2,1H3 |
| InChIKey | HNXOOFNMQBRBRM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate (CID 569723) is ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate is CCOC(=O)C1C(=O)CC(O)(c2ccccc2)CC1c1ccccc1.
What is the InChIKey of ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate?
The InChIKey is HNXOOFNMQBRBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O4/c1-2-25-20(23)19-17(15-9-5-3-6-10-15)13-21(24,14-18(19)22)16-11-7-4-8-12-16/h3-12,17,19,24H,2,13-14H2,1H3.
What are the key properties of ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate?
ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate has a molecular weight of 338.40 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-2-oxo-4,6-diphenylcyclohexane-1-carboxylate is sourced from PubChem (CID 569723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).