About 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene
3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene (PubChem CID 56972315) has the molecular formula C6H4N2
and a molecular weight of 104.11 g/mol. Its IUPAC name is 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene.
Analyze 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene?
The IUPAC name of 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene (CID 56972315) is 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene.
What is the SMILES notation for 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene?
The canonical SMILES for 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene is C1=c2ccncc2=N1.
What is the InChIKey of 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene?
The InChIKey is WXKUKKPOZZMFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2/c1-2-7-4-6-5(1)3-8-6/h1-4H.
What are the key properties of 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene?
3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene has a molecular weight of 104.11 g/mol, XLogP of -0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-diazabicyclo[4.2.0]octa-1(8),2,4,6-tetraene is sourced from PubChem (CID 56972315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).