About 2H-pyrrolo[2,3-b]pyridine
2H-pyrrolo[2,3-b]pyridine (PubChem CID 56972323) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 2H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 56972323 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 2H-pyrrolo[2,3-b]pyridine |
| SMILES | C1=c2cccnc2=NC1 |
| InChI | InChI=1S/C7H6N2/c1-2-6-3-5-9-7(6)8-4-1/h1-4H,5H2 |
| InChIKey | MHQCFIKCDJVVHP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2H-pyrrolo[2,3-b]pyridine (CID 56972323) is 2H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2H-pyrrolo[2,3-b]pyridine is C1=c2cccnc2=NC1.
What is the InChIKey of 2H-pyrrolo[2,3-b]pyridine?
The InChIKey is MHQCFIKCDJVVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-6-3-5-9-7(6)8-4-1/h1-4H,5H2.
What are the key properties of 2H-pyrrolo[2,3-b]pyridine?
2H-pyrrolo[2,3-b]pyridine has a molecular weight of 118.14 g/mol, XLogP of -0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 56972323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).