About oxadiazolo[5,4-b]pyridine
oxadiazolo[5,4-b]pyridine (PubChem CID 56972355) has the molecular formula C5H3N3O
and a molecular weight of 121.10 g/mol. Its IUPAC name is oxadiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | oxadiazolo[5,4-b]pyridine |
| PubChem CID | 56972355 |
| Molecular Formula | C5H3N3O |
| Molecular Weight | 121.10 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | oxadiazolo[5,4-b]pyridine |
| SMILES | c1cnc2onnc2c1 |
| InChI | InChI=1S/C5H3N3O/c1-2-4-5(6-3-1)9-8-7-4/h1-3H |
| InChIKey | RWXCVESEMJNNMF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxadiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazolo[5,4-b]pyridine?
The IUPAC name of oxadiazolo[5,4-b]pyridine (CID 56972355) is oxadiazolo[5,4-b]pyridine.
What is the SMILES notation for oxadiazolo[5,4-b]pyridine?
The canonical SMILES for oxadiazolo[5,4-b]pyridine is c1cnc2onnc2c1.
What is the InChIKey of oxadiazolo[5,4-b]pyridine?
The InChIKey is RWXCVESEMJNNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3O/c1-2-4-5(6-3-1)9-8-7-4/h1-3H.
What are the key properties of oxadiazolo[5,4-b]pyridine?
oxadiazolo[5,4-b]pyridine has a molecular weight of 121.10 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazolo[5,4-b]pyridine is sourced from PubChem (CID 56972355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).