About 1-azidoethylbenzene
1-azidoethylbenzene (PubChem CID 569726) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-azidoethylbenzene.
Molecular Properties
| Compound Name | 1-azidoethylbenzene |
| PubChem CID | 569726 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-azidoethylbenzene |
| SMILES | CC(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C8H9N3/c1-7(10-11-9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | KOFFFKMEMKRWMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidoethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidoethylbenzene?
The IUPAC name of 1-azidoethylbenzene (CID 569726) is 1-azidoethylbenzene.
What is the SMILES notation for 1-azidoethylbenzene?
The canonical SMILES for 1-azidoethylbenzene is CC(N=[N+]=[N-])c1ccccc1.
What is the InChIKey of 1-azidoethylbenzene?
The InChIKey is KOFFFKMEMKRWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-7(10-11-9)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-azidoethylbenzene?
1-azidoethylbenzene has a molecular weight of 147.18 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidoethylbenzene is sourced from PubChem (CID 569726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).