About 2-methylpiperidin-3-one
2-methylpiperidin-3-one (PubChem CID 56972713) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-methylpiperidin-3-one.
Molecular Properties
| Compound Name | 2-methylpiperidin-3-one |
| PubChem CID | 56972713 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-methylpiperidin-3-one |
| SMILES | CC1NCCCC1=O |
| InChI | InChI=1S/C6H11NO/c1-5-6(8)3-2-4-7-5/h5,7H,2-4H2,1H3 |
| InChIKey | YAGVBVXWOLWYNB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpiperidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpiperidin-3-one?
The IUPAC name of 2-methylpiperidin-3-one (CID 56972713) is 2-methylpiperidin-3-one.
What is the SMILES notation for 2-methylpiperidin-3-one?
The canonical SMILES for 2-methylpiperidin-3-one is CC1NCCCC1=O.
What is the InChIKey of 2-methylpiperidin-3-one?
The InChIKey is YAGVBVXWOLWYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-5-6(8)3-2-4-7-5/h5,7H,2-4H2,1H3.
What are the key properties of 2-methylpiperidin-3-one?
2-methylpiperidin-3-one has a molecular weight of 113.16 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpiperidin-3-one is sourced from PubChem (CID 56972713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).