About 6-methyl-3,4-dihydro-2H-pyridin-5-one
6-methyl-3,4-dihydro-2H-pyridin-5-one (PubChem CID 56972721) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-pyridin-5-one.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-2H-pyridin-5-one |
| PubChem CID | 56972721 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-pyridin-5-one |
| SMILES | CC1=NCCCC1=O |
| InChI | InChI=1S/C6H9NO/c1-5-6(8)3-2-4-7-5/h2-4H2,1H3 |
| InChIKey | JSLAOZYDIINKAF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3,4-dihydro-2H-pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-pyridin-5-one?
The IUPAC name of 6-methyl-3,4-dihydro-2H-pyridin-5-one (CID 56972721) is 6-methyl-3,4-dihydro-2H-pyridin-5-one.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-pyridin-5-one?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-pyridin-5-one is CC1=NCCCC1=O.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-pyridin-5-one?
The InChIKey is JSLAOZYDIINKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-5-6(8)3-2-4-7-5/h2-4H2,1H3.
What are the key properties of 6-methyl-3,4-dihydro-2H-pyridin-5-one?
6-methyl-3,4-dihydro-2H-pyridin-5-one has a molecular weight of 111.14 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-pyridin-5-one is sourced from PubChem (CID 56972721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).