C16H22BNO2 — CID 56973165
2,6-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile (PubChem CID 56973165) has the molecular formula C16H22BNO2 and a molecular weight of 271.17 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile.
| Compound Name | 2,6-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 56973165 |
| Molecular Formula | C16H22BNO2 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2,6-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
| SMILES | Cc1cc(CB2OC(C)(C)C(C)(C)O2)cc(C)c1C#N |
| InChI | InChI=1S/C16H22BNO2/c1-11-7-13(8-12(2)14(11)10-18)9-17-19-15(3,4)16(5,6)20-17/h7-8H,9H2,1-6H3 |
| InChIKey | URNGCOWRNFXVNA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|