C15H19BFNO2 — CID 56973262
6-fluoro-7-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 56973262) has the molecular formula C15H19BFNO2 and a molecular weight of 275.13 g/mol. Its IUPAC name is 6-fluoro-7-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 6-fluoro-7-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 56973262 |
| Molecular Formula | C15H19BFNO2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 6-fluoro-7-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | Cc1c(F)ccc2cc(B3OC(C)(C)C(C)(C)O3)[nH]c12 |
| InChI | InChI=1S/C15H19BFNO2/c1-9-11(17)7-6-10-8-12(18-13(9)10)16-19-14(2,3)15(4,5)20-16/h6-8,18H,1-5H3 |
| InChIKey | YIFLCEFOGHVFPC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|