About 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol
2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 56973691) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol |
| PubChem CID | 56973691 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC(C)C1(C(C)C)OC[C@@H](CCO)O1 |
| InChI | InChI=1S/C11H22O3/c1-8(2)11(9(3)4)13-7-10(14-11)5-6-12/h8-10,12H,5-7H2,1-4H3/t10-/m1/s1 |
| InChIKey | XFPZNMFFBDUEGH-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol?
The IUPAC name of 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol (CID 56973691) is 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol.
What is the SMILES notation for 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol?
The canonical SMILES for 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol is CC(C)C1(C(C)C)OC[C@@H](CCO)O1.
What is the InChIKey of 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol?
The InChIKey is XFPZNMFFBDUEGH-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H22O3/c1-8(2)11(9(3)4)13-7-10(14-11)5-6-12/h8-10,12H,5-7H2,1-4H3/t10-/m1/s1.
What are the key properties of 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol?
2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol has a molecular weight of 202.29 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol is sourced from PubChem (CID 56973691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).