C13H16N2O — CID 56973738
5-methyl-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol (PubChem CID 56973738) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-methyl-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol.
| Compound Name | 5-methyl-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 56973738 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-methyl-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol |
| SMILES | Cc1ccc(NC2=NC=CCC2C)c(O)c1 |
| InChI | InChI=1S/C13H16N2O/c1-9-5-6-11(12(16)8-9)15-13-10(2)4-3-7-14-13/h3,5-8,10,16H,4H2,1-2H3,(H,14,15) |
| InChIKey | FGFQYSHAIPDGDZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|