C16H24F2O3 — CID 56973971
(3aR,4R,5R,6aS)-4-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 56973971) has the molecular formula C16H24F2O3 and a molecular weight of 302.36 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 56973971 |
| Molecular Formula | C16H24F2O3 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)(F)[C@@H](O)C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C16H24F2O3/c1-3-4-7-16(17,18)14(19)6-5-11-10(2)8-13-12(11)9-15(20)21-13/h5-6,10-14,19H,3-4,7-9H2,1-2H3/t10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | HXIYHCPULJBGNI-BJJPWKGXSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|