C23H40N2O7 — CID 56974515
1-O,2-O-ditert-butyl 4-O-methyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]pyrrolidine-1,2,4-tricarboxylate (PubChem CID 56974515) has the molecular formula C23H40N2O7 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1-O,2-O-ditert-butyl 4-O-methyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]pyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-ditert-butyl 4-O-methyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]pyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 56974515 |
| Molecular Formula | C23H40N2O7 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-O,2-O-ditert-butyl 4-O-methyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]pyrrolidine-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1CC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C23H40N2O7/c1-13(2)11-16(24-14(3)26)18-15(19(27)30-10)12-17(20(28)31-22(4,5)6)25(18)21(29)32-23(7,8)9/h13,15-18H,11-12H2,1-10H3,(H,24,26)/t15-,16+,17?,18-/m1/s1 |
| InChIKey | VLBJZSKDPZYHEI-UJJTZGENSA-N |
| XLogP | 3.05 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|