C23H33NO5Si — CID 56974792
3-O-tert-butyl 5-O-methyl (4S,5R)-2,2-dimethyl-4-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 56974792) has the molecular formula C23H33NO5Si and a molecular weight of 431.61 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-methyl (4S,5R)-2,2-dimethyl-4-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-methyl (4S,5R)-2,2-dimethyl-4-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 56974792 |
| Molecular Formula | C23H33NO5Si |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-O-tert-butyl 5-O-methyl (4S,5R)-2,2-dimethyl-4-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1c1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C23H33NO5Si/c1-22(2,3)29-21(26)24-18(19(20(25)27-6)28-23(24,4)5)17-12-10-16(11-13-17)14-15-30(7,8)9/h10-13,18-19H,1-9H3/t18-,19+/m0/s1 |
| InChIKey | IRCUGIZWMHHZPC-RBUKOAKNSA-N |
| XLogP | 4.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|