C15H21FO5 — CID 56974884
methyl (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 56974884) has the molecular formula C15H21FO5 and a molecular weight of 300.33 g/mol. Its IUPAC name is methyl (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 56974884 |
| Molecular Formula | C15H21FO5 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCOC(C)O[C@@H]1OC=C(C(=O)OC)[C@H]2CC=C(CF)[C@H]12 |
| InChI | InChI=1S/C15H21FO5/c1-4-19-9(2)21-15-13-10(7-16)5-6-11(13)12(8-20-15)14(17)18-3/h5,8-9,11,13,15H,4,6-7H2,1-3H3/t9?,11-,13+,15+/m1/s1 |
| InChIKey | VTNGYHUZHCDEIB-LBLBLNHASA-N |
| XLogP | 2.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|