About 2H-2-benzazepin-3-amine
2H-2-benzazepin-3-amine (PubChem CID 56975039) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2H-2-benzazepin-3-amine.
Molecular Properties
| Compound Name | 2H-2-benzazepin-3-amine |
| PubChem CID | 56975039 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2H-2-benzazepin-3-amine |
| SMILES | NC1=CC=c2ccccc2=CN1 |
| InChI | InChI=1S/C10H10N2/c11-10-6-5-8-3-1-2-4-9(8)7-12-10/h1-7,12H,11H2 |
| InChIKey | VJSJXTHOCMMIRF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-2-benzazepin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-2-benzazepin-3-amine?
The IUPAC name of 2H-2-benzazepin-3-amine (CID 56975039) is 2H-2-benzazepin-3-amine.
What is the SMILES notation for 2H-2-benzazepin-3-amine?
The canonical SMILES for 2H-2-benzazepin-3-amine is NC1=CC=c2ccccc2=CN1.
What is the InChIKey of 2H-2-benzazepin-3-amine?
The InChIKey is VJSJXTHOCMMIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c11-10-6-5-8-3-1-2-4-9(8)7-12-10/h1-7,12H,11H2.
What are the key properties of 2H-2-benzazepin-3-amine?
2H-2-benzazepin-3-amine has a molecular weight of 158.20 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-2-benzazepin-3-amine is sourced from PubChem (CID 56975039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).