C18H38N4 — CID 56975408
1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hydrazine (PubChem CID 56975408) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hydrazine.
| Compound Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 56975408 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hydrazine |
| SMILES | CC1(C)CC(N(N)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H38N4/c1-15(2)9-13(10-16(3,4)20-15)22(19)14-11-17(5,6)21-18(7,8)12-14/h13-14,20-21H,9-12,19H2,1-8H3 |
| InChIKey | IKKQYTSORIEENG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|