C20H20F3N3O3 — CID 56975562
2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]acetamide (PubChem CID 56975562) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]acetamide.
| Compound Name | 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 56975562 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]acetamide |
| SMILES | C=C(NOCc1cccc(C(F)(F)F)c1)c1ccccc1C(=NOC)C(=O)NC |
| InChI | InChI=1S/C20H20F3N3O3/c1-13(25-29-12-14-7-6-8-15(11-14)20(21,22)23)16-9-4-5-10-17(16)18(26-28-3)19(27)24-2/h4-11,25H,1,12H2,2-3H3,(H,24,27) |
| InChIKey | FAPSSOVCPLTPJE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|