About N-buta-1,3-dienyl-2-methylpropanamide
N-buta-1,3-dienyl-2-methylpropanamide (PubChem CID 56975603) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is N-buta-1,3-dienyl-2-methylpropanamide.
Molecular Properties
| Compound Name | N-buta-1,3-dienyl-2-methylpropanamide |
| PubChem CID | 56975603 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-buta-1,3-dienyl-2-methylpropanamide |
| SMILES | C=CC=CNC(=O)C(C)C |
| InChI | InChI=1S/C8H13NO/c1-4-5-6-9-8(10)7(2)3/h4-7H,1H2,2-3H3,(H,9,10) |
| InChIKey | VSJONKXXYRRKNS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dienyl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dienyl-2-methylpropanamide?
The IUPAC name of N-buta-1,3-dienyl-2-methylpropanamide (CID 56975603) is N-buta-1,3-dienyl-2-methylpropanamide.
What is the SMILES notation for N-buta-1,3-dienyl-2-methylpropanamide?
The canonical SMILES for N-buta-1,3-dienyl-2-methylpropanamide is C=CC=CNC(=O)C(C)C.
What is the InChIKey of N-buta-1,3-dienyl-2-methylpropanamide?
The InChIKey is VSJONKXXYRRKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-5-6-9-8(10)7(2)3/h4-7H,1H2,2-3H3,(H,9,10).
What are the key properties of N-buta-1,3-dienyl-2-methylpropanamide?
N-buta-1,3-dienyl-2-methylpropanamide has a molecular weight of 139.20 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dienyl-2-methylpropanamide is sourced from PubChem (CID 56975603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).