C10H14O4 — CID 56975823
(7S)-7-(hydroxymethyl)-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 56975823) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (7S)-7-(hydroxymethyl)-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | (7S)-7-(hydroxymethyl)-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 56975823 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (7S)-7-(hydroxymethyl)-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | O=C(O)C1COCC2C1C=C[C@@H]2CO |
| InChI | InChI=1S/C10H14O4/c11-3-6-1-2-7-8(6)4-14-5-9(7)10(12)13/h1-2,6-9,11H,3-5H2,(H,12,13)/t6-,7?,8?,9?/m1/s1 |
| InChIKey | ZURRQXCDJAAANR-LJSVPSOQSA-N |
| XLogP | 0.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|