About 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine
6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine (PubChem CID 56975988) has the molecular formula C15H36N4
and a molecular weight of 272.48 g/mol. Its IUPAC name is 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine |
| PubChem CID | 56975988 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine |
| SMILES | CC(CCNNCCCCCCN)CC(C)(C)CN |
| InChI | InChI=1S/C15H36N4/c1-14(12-15(2,3)13-17)8-11-19-18-10-7-5-4-6-9-16/h14,18-19H,4-13,16-17H2,1-3H3 |
| InChIKey | OXDYJCNLSNIFPT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine?
The IUPAC name of 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine (CID 56975988) is 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine.
What is the SMILES notation for 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine?
The canonical SMILES for 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine is CC(CCNNCCCCCCN)CC(C)(C)CN.
What is the InChIKey of 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine?
The InChIKey is OXDYJCNLSNIFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36N4/c1-14(12-15(2,3)13-17)8-11-19-18-10-7-5-4-6-9-16/h14,18-19H,4-13,16-17H2,1-3H3.
What are the key properties of 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine?
6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine has a molecular weight of 272.48 g/mol, XLogP of 2.00, 13 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(6-aminohexyl)hydrazinyl]-2,2,4-trimethylhexan-1-amine is sourced from PubChem (CID 56975988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).