C15H15BrO4S2 — CID 56976579
(6R,7R)-2-(benzenesulfonyl)-6-bromo-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-ol (PubChem CID 56976579) has the molecular formula C15H15BrO4S2 and a molecular weight of 403.32 g/mol. Its IUPAC name is (6R,7R)-2-(benzenesulfonyl)-6-bromo-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-ol.
| Compound Name | (6R,7R)-2-(benzenesulfonyl)-6-bromo-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-ol |
|---|---|
| PubChem CID | 56976579 |
| Molecular Formula | C15H15BrO4S2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | (6R,7R)-2-(benzenesulfonyl)-6-bromo-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-ol |
| SMILES | CC1(C)Oc2cc(S(=O)(=O)c3ccccc3)sc2[C@@H](O)[C@H]1Br |
| InChI | InChI=1S/C15H15BrO4S2/c1-15(2)14(16)12(17)13-10(20-15)8-11(21-13)22(18,19)9-6-4-3-5-7-9/h3-8,12,14,17H,1-2H3/t12-,14-/m1/s1 |
| InChIKey | NDAUWFAPOGXDNT-TZMCWYRMSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|