About 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid
4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid (PubChem CID 56976791) has the molecular formula C20H18O3S2
and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid |
| PubChem CID | 56976791 |
| Molecular Formula | C20H18O3S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid |
| SMILES | CSC1(SC)CCOc2ccc(C#Cc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C20H18O3S2/c1-24-20(25-2)11-12-23-18-10-7-15(13-17(18)20)4-3-14-5-8-16(9-6-14)19(21)22/h5-10,13H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | VFDQXOVUSRVUMC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid?
The IUPAC name of 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid (CID 56976791) is 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid.
What is the SMILES notation for 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid?
The canonical SMILES for 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid is CSC1(SC)CCOc2ccc(C#Cc3ccc(C(=O)O)cc3)cc21.
What is the InChIKey of 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid?
The InChIKey is VFDQXOVUSRVUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O3S2/c1-24-20(25-2)11-12-23-18-10-7-15(13-17(18)20)4-3-14-5-8-16(9-6-14)19(21)22/h5-10,13H,11-12H2,1-2H3,(H,21,22).
What are the key properties of 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid?
4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid has a molecular weight of 370.50 g/mol, XLogP of 4.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoic acid is sourced from PubChem (CID 56976791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).