C43H69NO10 — CID 56977384
12-(1-cyclohexylprop-1-en-2-yl)-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-17-propyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone (PubChem CID 56977384) has the molecular formula C43H69NO10 and a molecular weight of 760.02 g/mol. Its IUPAC name is 12-(1-cyclohexylprop-1-en-2-yl)-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-17-propyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone.
| Compound Name | 12-(1-cyclohexylprop-1-en-2-yl)-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-17-propyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
|---|---|
| PubChem CID | 56977384 |
| Molecular Formula | C43H69NO10 |
| Molecular Weight | 760.02 g/mol |
| Exact Mass | 759.49 |
| IUPAC Name | 12-(1-cyclohexylprop-1-en-2-yl)-1,14-dihydroxy-23,25-dimethoxy-13,19,21,27-tetramethyl-17-propyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacos-18-ene-2,3,10,16-tetrone |
| SMILES | CCCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCCCC3)C(C)C(O)CC1=O)C(C)CC2OC |
| InChI | InChI=1S/C43H69NO10/c1-9-15-32-21-26(2)20-27(3)22-36(51-7)39-37(52-8)24-29(5)43(50,54-39)40(47)41(48)44-19-14-13-18-33(44)42(49)53-38(30(6)34(45)25-35(32)46)28(4)23-31-16-11-10-12-17-31/h21,23,27,29-34,36-39,45,50H,9-20,22,24-25H2,1-8H3 |
| InChIKey | UVZZMZVDHWNNTN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.02 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|