C38H34FN5O7 — CID 56977467
N-[9-[(2R,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 56977467) has the molecular formula C38H34FN5O7 and a molecular weight of 691.72 g/mol. Its IUPAC name is N-[9-[(2R,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 56977467 |
| Molecular Formula | C38H34FN5O7 |
| Molecular Weight | 691.72 g/mol |
| Exact Mass | 691.24 |
| IUPAC Name | N-[9-[(2R,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@](O)(F)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H34FN5O7/c1-48-28-17-13-26(14-18-28)37(25-11-7-4-8-12-25,27-15-19-29(49-2)20-16-27)50-21-30-32(45)38(39,47)36(51-30)44-23-42-31-33(40-22-41-34(31)44)43-35(46)24-9-5-3-6-10-24/h3-20,22-23,30,32,36,45,47H,21H2,1-2H3,(H,40,41,43,46)/t30-,32-,36-,38-/m1/s1 |
| InChIKey | BULKUJMTTCQGLZ-LSLFJHCFSA-N |
| XLogP | 5.02 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.72 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|