C15H13ClF3NO — CID 56977519
5-(2-chloroethenyl)-3-methylimino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 56977519) has the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. Its IUPAC name is 5-(2-chloroethenyl)-3-methylimino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 5-(2-chloroethenyl)-3-methylimino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 56977519 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-(2-chloroethenyl)-3-methylimino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | C/N=C1\CC(C=CCl)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3NO/c1-20-12-8-10(5-6-16)14(21)13(12)9-3-2-4-11(7-9)15(17,18)19/h2-7,10,13H,8H2,1H3/b6-5?,20-12+ |
| InChIKey | HIPXXSTVKZIGBQ-MWJKBWPFSA-N |
| XLogP | 4.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|