About S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate
S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate (PubChem CID 56977569) has the molecular formula C11H8ClNO2S
and a molecular weight of 253.71 g/mol. Its IUPAC name is S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate.
Molecular Properties
| Compound Name | S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate |
| PubChem CID | 56977569 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate |
| SMILES | CC(=O)C(C#N)C(=O)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H8ClNO2S/c1-7(14)10(6-13)11(15)16-9-4-2-8(12)3-5-9/h2-5,10H,1H3 |
| InChIKey | BBFQJKHEPMQGKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate?
The IUPAC name of S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate (CID 56977569) is S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate.
What is the SMILES notation for S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate?
The canonical SMILES for S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate is CC(=O)C(C#N)C(=O)Sc1ccc(Cl)cc1.
What is the InChIKey of S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate?
The InChIKey is BBFQJKHEPMQGKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO2S/c1-7(14)10(6-13)11(15)16-9-4-2-8(12)3-5-9/h2-5,10H,1H3.
What are the key properties of S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate?
S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate has a molecular weight of 253.71 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-chlorophenyl) 2-cyano-3-oxobutanethioate is sourced from PubChem (CID 56977569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).