About 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one
1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one (PubChem CID 56977677) has the molecular formula C26H21ClN2O6
and a molecular weight of 492.92 g/mol. Its IUPAC name is 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one |
| PubChem CID | 56977677 |
| Molecular Formula | C26H21ClN2O6 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one |
| SMILES | O=C(Cn1cc(Cl)cnc1=O)c1ccc(C(O)(O)c2ccccc2)c(C(O)(O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H21ClN2O6/c27-20-14-28-24(31)29(15-20)16-23(30)17-11-12-21(25(32,33)18-7-3-1-4-8-18)22(13-17)26(34,35)19-9-5-2-6-10-19/h1-15,32-35H,16H2 |
| InChIKey | YVOXYBRYPVCYSH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one?
The IUPAC name of 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one (CID 56977677) is 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one.
What is the SMILES notation for 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one?
The canonical SMILES for 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one is O=C(Cn1cc(Cl)cnc1=O)c1ccc(C(O)(O)c2ccccc2)c(C(O)(O)c2ccccc2)c1.
What is the InChIKey of 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one?
The InChIKey is YVOXYBRYPVCYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21ClN2O6/c27-20-14-28-24(31)29(15-20)16-23(30)17-11-12-21(25(32,33)18-7-3-1-4-8-18)22(13-17)26(34,35)19-9-5-2-6-10-19/h1-15,32-35H,16H2.
What are the key properties of 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one?
1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one has a molecular weight of 492.92 g/mol, XLogP of 2.15, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[3,4-bis[dihydroxy(phenyl)methyl]phenyl]-2-oxoethyl]-5-chloropyrimidin-2-one is sourced from PubChem (CID 56977677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).