About 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran
2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran (PubChem CID 56977726) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 56977726 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran |
| SMILES | CC(C)(C)c1ccc(C2CC=CCO2)cc1 |
| InChI | InChI=1S/C15H20O/c1-15(2,3)13-9-7-12(8-10-13)14-6-4-5-11-16-14/h4-5,7-10,14H,6,11H2,1-3H3 |
| InChIKey | ALCXFNLLOLDYGN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran (CID 56977726) is 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran is CC(C)(C)c1ccc(C2CC=CCO2)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran?
The InChIKey is ALCXFNLLOLDYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O/c1-15(2,3)13-9-7-12(8-10-13)14-6-4-5-11-16-14/h4-5,7-10,14H,6,11H2,1-3H3.
What are the key properties of 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran?
2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran has a molecular weight of 216.32 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 56977726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).