C19H21NO — CID 56977748
(6aS,13bR)-12-methoxy-6,6a,7,8,13a,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepine (PubChem CID 56977748) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (6aS,13bR)-12-methoxy-6,6a,7,8,13a,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepine.
| Compound Name | (6aS,13bR)-12-methoxy-6,6a,7,8,13a,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepine |
|---|---|
| PubChem CID | 56977748 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (6aS,13bR)-12-methoxy-6,6a,7,8,13a,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepine |
| SMILES | COC1=CC2C(=CCN[C@H]3CCc4ccccc4[C@@H]23)C=C1 |
| InChI | InChI=1S/C19H21NO/c1-21-15-8-6-14-10-11-20-18-9-7-13-4-2-3-5-16(13)19(18)17(14)12-15/h2-6,8,10,12,17-20H,7,9,11H2,1H3/t17?,18-,19-/m0/s1 |
| InChIKey | OBDXEPGXKKWZIR-MNNMKWMVSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |