About benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate
benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate (PubChem CID 56977976) has the molecular formula C26H27NO6
and a molecular weight of 449.50 g/mol. Its IUPAC name is benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate |
| PubChem CID | 56977976 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate |
| SMILES | CON(C)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO6/c1-27(31-2)23(28)19-33-26(21-14-8-4-9-15-21,22-16-10-5-11-17-22)24(29)25(30)32-18-20-12-6-3-7-13-20/h3-17,24,29H,18-19H2,1-2H3 |
| InChIKey | OWRLJJNHZNRHTF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate?
The IUPAC name of benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate (CID 56977976) is benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate.
What is the SMILES notation for benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate?
The canonical SMILES for benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate is CON(C)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate?
The InChIKey is OWRLJJNHZNRHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO6/c1-27(31-2)23(28)19-33-26(21-14-8-4-9-15-21,22-16-10-5-11-17-22)24(29)25(30)32-18-20-12-6-3-7-13-20/h3-17,24,29H,18-19H2,1-2H3.
What are the key properties of benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate?
benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate has a molecular weight of 449.50 g/mol, XLogP of 3.07, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-hydroxy-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-3,3-diphenylpropanoate is sourced from PubChem (CID 56977976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).