C37H34N2O4 — CID 56978006
1-[(3aS,4S,7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethane-1,2-dione (PubChem CID 56978006) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is 1-[(3aS,4S,7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(3aS,4S,7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 56978006 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 1-[(3aS,4S,7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethane-1,2-dione |
| SMILES | COc1ccccc1[C@]1(O)CCC(c2ccccc2)(c2ccccc2)[C@H]2CN(C(=O)C(=O)c3c[nH]c4ccccc34)C[C@H]21 |
| InChI | InChI=1S/C37H34N2O4/c1-43-33-19-11-9-17-29(33)37(42)21-20-36(25-12-4-2-5-13-25,26-14-6-3-7-15-26)30-23-39(24-31(30)37)35(41)34(40)28-22-38-32-18-10-8-16-27(28)32/h2-19,22,30-31,38,42H,20-21,23-24H2,1H3/t30-,31+,37+/m0/s1 |
| InChIKey | HWNFOSBFMNUMKE-VJZHPIFNSA-N |
| XLogP | 6.10 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|