About 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate
2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate (PubChem CID 56978289) has the molecular formula C10H21N3O4
and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate |
| PubChem CID | 56978289 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate |
| SMILES | C/N=C(\N)NCCOCCOCCOC(C)=O |
| InChI | InChI=1S/C10H21N3O4/c1-9(14)17-8-7-16-6-5-15-4-3-13-10(11)12-2/h3-8H2,1-2H3,(H3,11,12,13) |
| InChIKey | QISSAJVNUUNNES-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate?
The IUPAC name of 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate (CID 56978289) is 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate.
What is the SMILES notation for 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate?
The canonical SMILES for 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate is C/N=C(\N)NCCOCCOCCOC(C)=O.
What is the InChIKey of 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate?
The InChIKey is QISSAJVNUUNNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O4/c1-9(14)17-8-7-16-6-5-15-4-3-13-10(11)12-2/h3-8H2,1-2H3,(H3,11,12,13).
What are the key properties of 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate?
2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate has a molecular weight of 247.29 g/mol, XLogP of -0.88, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[(N'-methylcarbamimidoyl)amino]ethoxy]ethoxy]ethyl acetate is sourced from PubChem (CID 56978289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).