About cyclohexane-1,2,3,5-tetracarbothialdehyde
cyclohexane-1,2,3,5-tetracarbothialdehyde (PubChem CID 56978506) has the molecular formula C10H12S4
and a molecular weight of 260.47 g/mol. Its IUPAC name is cyclohexane-1,2,3,5-tetracarbothialdehyde.
Molecular Properties
| Compound Name | cyclohexane-1,2,3,5-tetracarbothialdehyde |
| PubChem CID | 56978506 |
| Molecular Formula | C10H12S4 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | cyclohexane-1,2,3,5-tetracarbothialdehyde |
| SMILES | S=CC1CC(C=S)C(C=S)C(C=S)C1 |
| InChI | InChI=1S/C10H12S4/c11-3-7-1-8(4-12)10(6-14)9(2-7)5-13/h3-10H,1-2H2 |
| InChIKey | IZHHTELSKXXFNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,2,3,5-tetracarbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,2,3,5-tetracarbothialdehyde?
The IUPAC name of cyclohexane-1,2,3,5-tetracarbothialdehyde (CID 56978506) is cyclohexane-1,2,3,5-tetracarbothialdehyde.
What is the SMILES notation for cyclohexane-1,2,3,5-tetracarbothialdehyde?
The canonical SMILES for cyclohexane-1,2,3,5-tetracarbothialdehyde is S=CC1CC(C=S)C(C=S)C(C=S)C1.
What is the InChIKey of cyclohexane-1,2,3,5-tetracarbothialdehyde?
The InChIKey is IZHHTELSKXXFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S4/c11-3-7-1-8(4-12)10(6-14)9(2-7)5-13/h3-10H,1-2H2.
What are the key properties of cyclohexane-1,2,3,5-tetracarbothialdehyde?
cyclohexane-1,2,3,5-tetracarbothialdehyde has a molecular weight of 260.47 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,2,3,5-tetracarbothialdehyde is sourced from PubChem (CID 56978506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).