About methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate
methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate (PubChem CID 56978658) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate.
Analyze methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate?
The IUPAC name of methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate (CID 56978658) is methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate.
What is the SMILES notation for methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate?
The canonical SMILES for methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate is CCC1CC=NC(C(=O)OC)C1.
What is the InChIKey of methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate?
The InChIKey is NWFVRXSYBGSBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-3-7-4-5-10-8(6-7)9(11)12-2/h5,7-8H,3-4,6H2,1-2H3.
What are the key properties of methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate?
methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate has a molecular weight of 169.22 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethyl-2,3,4,5-tetrahydropyridine-2-carboxylate is sourced from PubChem (CID 56978658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).