C19H9F11O2 — CID 56978663
[2-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(trifluoromethyl)phenyl] 2-fluoroprop-2-enoate (PubChem CID 56978663) has the molecular formula C19H9F11O2 and a molecular weight of 478.26 g/mol. Its IUPAC name is [2-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(trifluoromethyl)phenyl] 2-fluoroprop-2-enoate.
| Compound Name | [2-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(trifluoromethyl)phenyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 56978663 |
| Molecular Formula | C19H9F11O2 |
| Molecular Weight | 478.26 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [2-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(trifluoromethyl)phenyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)Oc1ccc(C(F)(F)F)cc1-c1ccccc1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H9F11O2/c1-9(20)15(31)32-14-7-6-10(17(22,23)24)8-12(14)11-4-2-3-5-13(11)16(21,18(25,26)27)19(28,29)30/h2-8H,1H2 |
| InChIKey | RPPQQQDJSPANDS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.26 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|