About 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine
8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 56978742) has the molecular formula C18H14ClN3
and a molecular weight of 307.78 g/mol. Its IUPAC name is 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| PubChem CID | 56978742 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | ClCc1ccc2c(c1)C(c1ccccc1)=NCc1cncn1-2 |
| InChI | InChI=1S/C18H14ClN3/c19-9-13-6-7-17-16(8-13)18(14-4-2-1-3-5-14)21-11-15-10-20-12-22(15)17/h1-8,10,12H,9,11H2 |
| InChIKey | MGMDJRJERCFBEH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The IUPAC name of 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine (CID 56978742) is 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine.
What is the SMILES notation for 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The canonical SMILES for 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine is ClCc1ccc2c(c1)C(c1ccccc1)=NCc1cncn1-2.
What is the InChIKey of 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The InChIKey is MGMDJRJERCFBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3/c19-9-13-6-7-17-16(8-13)18(14-4-2-1-3-5-14)21-11-15-10-20-12-22(15)17/h1-8,10,12H,9,11H2.
What are the key properties of 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine has a molecular weight of 307.78 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(chloromethyl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine is sourced from PubChem (CID 56978742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).